CymitQuimica logo

CAS 132059-53-1

:

3-Bromo-4-(dibromomethyl)-5-hydroxy-2(5H)-furanone

Description:
3-Bromo-4-(dibromomethyl)-5-hydroxy-2(5H)-furanone, with the CAS number 132059-53-1, is a chemical compound characterized by its furanone structure, which includes a five-membered lactone ring containing both oxygen and carbon atoms. This compound features multiple bromine substituents, which significantly influence its reactivity and properties. The presence of the hydroxy group contributes to its potential as a reactive intermediate in organic synthesis. The bromine atoms can enhance the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the furanone moiety is known for its biological activity, which may include antimicrobial or antifungal properties. The compound's solubility and stability can vary depending on the solvent and environmental conditions, and it may exhibit distinct spectral characteristics in techniques such as NMR and IR spectroscopy. Overall, 3-Bromo-4-(dibromomethyl)-5-hydroxy-2(5H)-furanone is of interest in both synthetic organic chemistry and potential pharmaceutical applications.
Formula:C5H3Br3O3
InChI:InChI=1S/C5H3Br3O3/c6-2-1(3(7)8)4(9)11-5(2)10/h3-4,9H
InChI key:InChIKey=FAPCZAUMFXUDMS-UHFFFAOYSA-N
SMILES:C(Br)(Br)C1=C(Br)C(=O)OC1O
Synonyms:
  • 132059-53-1
  • 2(5H)-Furanone, 3-bromo-4-(dibromomethyl)-5-hydroxy-
  • 3-Bromo-4-(dibromomethyl)-5-hydroxy-2(5H)-furanone
  • Bmx 3
  • 3-Bromo-4-(dibromomethyl)-5-hydroxyfuran-2(5H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.