CAS 13207-47-1
:N,1-Diphenylhydrazinecarbothioamide
Description:
N,1-Diphenylhydrazinecarbothioamide is an organic compound characterized by the presence of a hydrazine functional group and a thiocarbonyl moiety. It typically appears as a solid, and its molecular structure features two phenyl groups attached to a hydrazine backbone, which contributes to its stability and reactivity. The compound is known for its potential applications in organic synthesis and as a reagent in various chemical reactions, particularly in the formation of azo compounds. Its thiocarbonyl group can participate in nucleophilic addition reactions, making it a versatile intermediate in synthetic chemistry. Additionally, N,1-Diphenylhydrazinecarbothioamide may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data indicates that, like many hydrazine derivatives, it should be handled with care due to potential toxicity and reactivity. Proper storage and handling protocols are essential to mitigate risks associated with exposure. Overall, this compound serves as an important building block in the field of organic chemistry.
Formula:C13H13N3S
InChI:InChI=1S/C13H13N3S/c14-16(12-9-5-2-6-10-12)13(17)15-11-7-3-1-4-8-11/h1-10H,14H2,(H,15,17)
InChI key:InChIKey=AIONMUKAPQSLHW-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=CC=C1)=S)(N)C2=CC=CC=C2
Synonyms:- N,1-Diphenylhydrazinecarbothioamide
- N-Amino-N,N′-diphenylthiourea
- 1-Amino-1,3-diphenylthiourea
- Semicarbazide, 2,4-diphenyl-3-thio-
- Hydrazinecarbothioamide, N,1-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
