
CAS 13207-50-6
:N-Methyl-2-phenylhydrazinecarbothioamide
Description:
N-Methyl-2-phenylhydrazinecarbothioamide, with the CAS number 13207-50-6, is an organic compound characterized by the presence of a hydrazine functional group, a methyl group, and a phenyl group, along with a carbothioamide moiety. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry. It exhibits properties associated with both hydrazines and thioamides, which may include reactivity towards electrophiles and nucleophiles, making it useful in various chemical reactions. The presence of the phenyl group contributes to its aromatic characteristics, potentially influencing its stability and reactivity. Additionally, compounds of this nature may exhibit biological activity, warranting investigation into their pharmacological properties. Safety considerations are important, as hydrazine derivatives can be toxic and potentially carcinogenic, necessitating careful handling and appropriate safety measures in laboratory settings. Overall, N-Methyl-2-phenylhydrazinecarbothioamide represents a compound of interest in both synthetic and biological chemistry contexts.
Formula:C8H11N3S
InChI:InChI=1S/C8H11N3S/c1-9-8(12)11-10-7-5-3-2-4-6-7/h2-6,10H,1H3,(H2,9,11,12)
InChI key:InChIKey=TVQONGCRGGWBOT-UHFFFAOYSA-N
SMILES:N(NC(NC)=S)C1=CC=CC=C1
Synonyms:- 4-Methyl-1-phenyl-3-thiosemicarbazide
- Hydrazinecarbothioamide, N-methyl-2-phenyl-
- 4-Methyl-1-phenylthiosemicarbazide
- N-Methyl-2-phenylhydrazinecarbothioamide
- Semicarbazide, 4-methyl-1-phenyl-3-thio-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
