
CAS 13208-64-5
:N-(4-Chlorophenyl)-N′-propylurea
Description:
N-(4-Chlorophenyl)-N′-propylurea, with the CAS number 13208-64-5, is an organic compound characterized by its urea functional group, which is linked to a propyl group and a 4-chlorophenyl moiety. This compound typically appears as a solid at room temperature and is known for its role in various chemical applications, including as a herbicide and in agricultural chemistry. Its molecular structure features a central carbonyl group (C=O) bonded to two nitrogen atoms, one of which is attached to a propyl chain and the other to a chlorinated phenyl group. The presence of the chlorine atom enhances its biological activity and lipophilicity, influencing its interaction with biological systems. N-(4-Chlorophenyl)-N′-propylurea is generally soluble in organic solvents, and its stability can be affected by environmental conditions such as pH and temperature. Safety data sheets should be consulted for handling and toxicity information, as with many chemical substances, proper precautions are necessary to mitigate potential hazards.
Formula:C10H13ClN2O
InChI:InChI=1S/C10H13ClN2O/c1-2-7-12-10(14)13-9-5-3-8(11)4-6-9/h3-6H,2,7H2,1H3,(H2,12,13,14)
InChI key:InChIKey=ZOHMWYYUJMHIGF-UHFFFAOYSA-N
SMILES:N(C(NCCC)=O)C1=CC=C(Cl)C=C1
Synonyms:- 1-(4-Chloro-phenyl)-3-propyl-urea
- 1-(p-Chlorophenyl)-3-propylurea
- Urea, 1-(p-chlorophenyl)-3-propyl-
- Urea, N-(4-chlorophenyl)-N′-propyl-
- N-(4-Chlorophenyl)-N′-propylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
