CymitQuimica logo

CAS 132089-36-2

:

2-(2-CHLORO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER

Description:
2-(2-Chloro-phenyl)-thiazole-4-carboxylic acid ethyl ester is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a chloro group on the phenyl ring enhances its reactivity and may influence its biological activity. This compound features an ethyl ester functional group, which typically increases lipophilicity, potentially affecting its solubility and permeability in biological systems. The carboxylic acid moiety contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many thiazole derivatives, it may also possess antimicrobial or anti-inflammatory properties, although specific biological activities would need to be confirmed through experimental studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H10ClNO2S
InChI:InChI=1/C12H10ClNO2S/c1-2-16-12(15)10-7-17-11(14-10)8-5-3-4-6-9(8)13/h3-7H,2H2,1H3
SMILES:CCOC(=O)c1csc(c2ccccc2Cl)n1
Synonyms:
  • Ethyl 2-(2-Chlorophenyl)-1,3-Thiazole-4-Carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.