CAS 13209-41-1: (16α)-17,21-Dihydroxy-16-methylpregna-1,4,9(11)-triene-3,20-dione
Description:The chemical substance "(16α)-17,21-Dihydroxy-16-methylpregna-1,4,9(11)-triene-3,20-dione," with the CAS number 13209-41-1, is a synthetic steroid that belongs to the class of corticosteroids. It is characterized by a complex steroid structure, featuring multiple hydroxyl (-OH) groups that contribute to its biological activity. The presence of the 16-methyl group and the specific double bonds in the steroid nucleus influence its pharmacological properties, including anti-inflammatory and immunosuppressive effects. This compound is often studied for its potential therapeutic applications, particularly in the treatment of various inflammatory conditions and disorders related to the immune system. Its solubility, stability, and interaction with biological receptors are critical factors that determine its efficacy and safety profile. As with many steroids, it may exhibit a range of side effects, necessitating careful consideration in clinical use. Overall, this compound exemplifies the intricate relationship between chemical structure and biological function in medicinal chemistry.
Formula:C22H28O4
InChI:InChI=1S/C22H28O4/c1-13-10-18-16-5-4-14-11-15(24)6-8-20(14,2)17(16)7-9-21(18,3)22(13,26)19(25)12-23/h6-8,11,13,16,18,23,26H,4-5,9-10,12H2,1-3H3/t13-,16-,18+,20+,21+,22+/m1/s1
InChI key:InChIKey=ZYTXTXAMMDTYDQ-DGEXFFLYSA-N
SMILES:O=C1C=CC2(C(=C1)CCC3C2=CCC4(C)C3CC(C)C4(O)C(=O)CO)C
- Synonyms:
- (16Alpha)-17,21-Dihydroxy-16-Methylpregna-1,4,9(11)-Triene-3,20-Dione
- (16α)-17,21-Dihydroxy-16-methylpregna-1,4,9(11)-triene-3,20-dione
- 13209-41-1
- 17α,21-Dihydroxy-16α-methylpregna-1,4,9(11)-triene-3,20-dione
- Pregna-1,4,9(11)-triene-3,20-dione, 17,21-dihydroxy-16-methyl-, (16α)-
- Pregna-1,4,9(11)-triene-3,20-dione, 17,21-dihydroxy-16α-methyl-
- Vamorolone
- Vbp 15
