CAS 132095-53-5

5-Bromo-2-tetralone

Description:

5-Bromo-2-tetralone is an organic compound characterized by its bicyclic structure, which consists of a naphthalene-like framework with a ketone functional group and a bromine substituent. The presence of the bromine atom at the 5-position of the tetralone ring influences its reactivity and physical properties, such as solubility and boiling point. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The ketone group contributes to its reactivity, allowing for various chemical transformations, including nucleophilic additions and reductions. Additionally, 5-Bromo-2-tetralone can serve as an intermediate in the synthesis of more complex molecules. Its unique structure and functional groups make it a valuable compound in research and industrial applications, particularly in the fields of medicinal chemistry and materials science. Safety precautions should be observed when handling this compound, as with many brominated organic substances, due to potential toxicity and environmental concerns.

Formula: C₁₀H₉BrO

InChI: InChI=1/C10H9BrO/c11-10-3-1-2-7-6-8(12)4-5-9(7)10/h1-3H,4-6H2

SMILES: c1cc2CC(=O)CCc2c(c1)Br

Synonyms:

• 5-Bromo-3,4-dihydro-1H-naphthalen-2-one
• 5-bromo-3,4-dihydronaphthalen-2(1H)-one

2(1H)-Naphthalenone, 5-bromo-3,4-dihydro-

CAS: 132095-53-5

Formula: C₁₀H₉BrO

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.0819

Ref: IN-DA00106Q

5-Bromo-2-tetralone

CAS: 132095-53-5

5-Bromo-2-tetralone

Purity: 97%

Molecular weight: 225.08g/mol

Ref: 54-OR83549

5-Bromo-3,4-dihydronaphthalen-2(1H)-one

CAS: 132095-53-5

Formula: C₁₀H₉BrO

Purity: 97%

Molecular weight: 225.085

Ref: 10-F217124

5-Bromo-2-tetralone

Controlled Product

CAS: 132095-53-5

Formula: C₁₀H₉BrO

Color and Shape: Neat

Molecular weight: 225.082

Ref: TR-B116465