CAS 132116-39-3
:peptide 74
Description:
Peptide 74, identified by its CAS number 132116-39-3, is a synthetic peptide that is often studied for its biological activity and potential therapeutic applications. Peptides like Peptide 74 typically consist of a short chain of amino acids linked by peptide bonds, which can influence their structure and function. The characteristics of such peptides may include their solubility in water or organic solvents, stability under various pH conditions, and their ability to interact with specific biological targets, such as receptors or enzymes. Peptide 74 may exhibit specific biological activities, including antimicrobial, anti-inflammatory, or immunomodulatory effects, depending on its amino acid sequence and conformation. Additionally, the peptide's efficacy and safety profile would be assessed through various in vitro and in vivo studies. Understanding the characteristics of Peptide 74 is crucial for its potential applications in drug development, biotechnology, and research in molecular biology.
Formula:C62H107N23O20S2
InChI:InChI=1/C62H107N23O20S2/c1-29(2)47(57(101)74-30(3)48(92)81-38(60(104)105)25-43(65)88)83-53(97)36(26-45(90)91)80-55(99)41-16-11-22-85(41)59(103)37(24-42(64)87)75-44(89)27-73-49(93)39(28-106)82-51(95)33(14-9-20-72-62(69)70)77-54(98)40-15-10-21-84(40)58(102)35(12-6-7-18-63)79-50(94)32(13-8-19-71-61(67)68)76-52(96)34(17-23-107-5)78-56(100)46(66)31(4)86/h29-41,46-47,86,106H,6-28,63,66H2,1-5H3,(H2,64,87)(H2,65,88)(H,73,93)(H,74,101)(H,75,89)(H,76,96)(H,77,98)(H,78,100)(H,79,94)(H,80,99)(H,81,92)(H,82,95)(H,83,97)(H,90,91)(H,104,105)(H4,67,68,71)(H4,69,70,72)/t30-,31+,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,46-,47-/m0/s1
Synonyms:- L-threonyl-L-methionyl-N~5~-(diaminomethylidene)-L-ornithyl-L-lysyl-L-prolyl-N~5~-(diaminomethylidene)-L-ornithyl-L-cysteinylglycyl-L-asparaginyl-L-prolyl-L-alpha-aspartyl-L-valyl-L-alanyl-L-asparagine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Peptide 74
CAS:<p>Peptide 74 is a synthetic peptide. It also inhibits the activated form of this enzyme.</p>Formula:C62H107N23O20S2Purity:98%Color and Shape:SolidMolecular weight:1558.79Peptide 74
CAS:<p>Peptide 74 is a synthetic drug that has been shown to inhibit the activity of matrix metalloproteinases, which are enzymes that break down collagen in the extracellular matrix. This peptide also inhibits cell invasiveness and migration. It has been shown to be effective at inhibiting cancer cell growth, although it does not affect normal cells. The peptide is a receptor for the LDL-receptor and inhibits LDL uptake into macrophages. The peptides have also been shown to inhibit angiogenesis and tumor growth in animals by blocking VEGF receptors.</p>Formula:C62H107N23O20S2Purity:Min. 95%Molecular weight:1,558.79 g/mol

