CAS 132116-62-2
:peptide 78
Description:
Peptide 78, identified by its CAS number 132116-62-2, is a synthetic peptide that is often studied for its potential biological activities. While specific characteristics can vary based on its formulation and context, peptides like Peptide 78 typically consist of a sequence of amino acids linked by peptide bonds, which can influence their structure and function. These peptides may exhibit properties such as solubility in water or organic solvents, depending on their amino acid composition. Peptide 78 has been investigated for its role in various biological processes, including potential applications in therapeutic areas such as immunology or endocrinology. Its stability, bioactivity, and interaction with biological targets can be influenced by factors such as pH, temperature, and the presence of other molecules. As with many peptides, understanding its mechanism of action and pharmacokinetics is crucial for evaluating its potential uses in research and medicine. Further studies are often required to fully elucidate its characteristics and applications.
Formula:C62H107N23O21S
InChI:InChI=1/C62H107N23O21S/c1-29(2)47(57(102)74-30(3)48(93)81-38(60(105)106)25-43(65)89)83-53(98)36(26-45(91)92)80-55(100)41-16-11-22-85(41)59(104)37(24-42(64)88)75-44(90)27-73-49(94)39(28-86)82-51(96)33(14-9-20-72-62(69)70)77-54(99)40-15-10-21-84(40)58(103)35(12-6-7-18-63)79-50(95)32(13-8-19-71-61(67)68)76-52(97)34(17-23-107-5)78-56(101)46(66)31(4)87/h29-41,46-47,86-87H,6-28,63,66H2,1-5H3,(H2,64,88)(H2,65,89)(H,73,94)(H,74,102)(H,75,90)(H,76,97)(H,77,99)(H,78,101)(H,79,95)(H,80,100)(H,81,93)(H,82,96)(H,83,98)(H,91,92)(H,105,106)(H4,67,68,71)(H4,69,70,72)/t30-,31+,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,46-,47-/m0/s1
Synonyms:- Peptide 78
- L-threonyl-L-methionyl-N~5~-(diaminomethylidene)-L-ornithyl-L-lysyl-L-prolyl-N~5~-(diaminomethylidene)-L-ornithyl-L-serylglycyl-L-asparaginyl-L-prolyl-L-alpha-aspartyl-L-valyl-L-alanyl-L-asparagine
- L-Asparagine, L-threonyl-L-methionyl-L-arginyl-L-lysyl-L-propyl-L-arginyl-L-serylglycyl-L-asparaginyl-L-prolyl-L-alpha-aspartyl-L-valyl-L-alanyl-
- Threonyl-methionyl-argininyl-lysyl-prolyl-arginyl-seryl-glycyl-asparaginyl-prolyl-aspartyl-valyl-alanyl-asparagine
- L-Threonyl-L-methionyl-L-arginyl-L-lysyl-L-propyl-L-arginyl-L-serylglycyl-L-asparaginyl-L-prolyl-L-alpha-aspartyl-L-valyl-L-alanyl-L-asparagine
- Thr-met-arg-lys-pro-arg-ser-gly-asn-pro-asp-val-ala-asn
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Peptide 78
CAS:Peptide 78 is identical to peptide 74 except that serine replaces cysteine. It does not inhibit 72-kDa type IV collagenase.Formula:C62H107N23O21SPurity:98%Color and Shape:SolidMolecular weight:1542.74
