
CAS 132118-30-0
:2-Chloro-8-ethyl-3-methylquinoline
Description:
2-Chloro-8-ethyl-3-methylquinoline is a heterocyclic organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features a chlorine atom at the second position, an ethyl group at the eighth position, and a methyl group at the third position of the quinoline ring. It is typically a yellow to brown solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the ethyl and methyl groups can affect the compound's physical properties, such as boiling and melting points, as well as its biological activity. Compounds of this type may have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with chlorine-containing compounds.
Formula:C12H12ClN
InChI:InChI=1S/C12H12ClN/c1-3-9-5-4-6-10-7-8(2)12(13)14-11(9)10/h4-7H,3H2,1-2H3
InChI key:InChIKey=SWNWAQYOGPBVDV-UHFFFAOYSA-N
SMILES:C(C)C=1C2=C(C=C(C)C(Cl)=N2)C=CC1
Synonyms:- 2-Chloro-8-ethyl-3-methylquinoline
- Quinoline, 2-chloro-8-ethyl-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
