CAS 132118-46-8
:2,7-Dichloro-3-methylquinoline
Description:
2,7-Dichloro-3-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features two chlorine substituents at the 2 and 7 positions and a methyl group at the 3 position of the quinoline ring. It is typically a yellow to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of chlorine atoms contributes to its potential reactivity and biological activity, making it of interest in various fields, including medicinal chemistry and materials science. Its molecular structure allows for potential interactions with biological targets, which may lead to applications in pharmaceuticals. Additionally, the compound's properties can be influenced by the presence of the chlorine and methyl groups, affecting its electronic characteristics and reactivity. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C10H7Cl2N
InChI:InChI=1S/C10H7Cl2N/c1-6-4-7-2-3-8(11)5-9(7)13-10(6)12/h2-5H,1H3
InChI key:InChIKey=QYWWVQLUBNPSGD-UHFFFAOYSA-N
SMILES:ClC1=NC2=C(C=C1C)C=CC(Cl)=C2
Synonyms:- Quinoline, 2,7-dichloro-3-methyl-
- 2,7-Dichloro-3-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
