
CAS 132118-50-4
:Quinoline, 2-chloro-3-ethyl-7-methoxy-
Description:
Quinoline, 2-chloro-3-ethyl-7-methoxy- is an organic compound that belongs to the quinoline family, characterized by a bicyclic structure consisting of a benzene ring fused to a pyridine ring. This specific compound features a chloro substituent at the second position, an ethyl group at the third position, and a methoxy group at the seventh position of the quinoline ring. The presence of these substituents influences its chemical properties, including its solubility, reactivity, and potential biological activity. Quinoline derivatives are known for their diverse applications, particularly in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound may exhibit various biological activities, including antimicrobial and antimalarial properties, making it of interest in medicinal chemistry. Its molecular structure contributes to its unique characteristics, such as its melting point, boiling point, and spectral properties, which can be analyzed using techniques like NMR and mass spectrometry. Overall, 2-chloro-3-ethyl-7-methoxy-quinoline represents a significant compound within the realm of heterocyclic chemistry.
Formula:C12H12ClNO
InChI:InChI=1S/C12H12ClNO/c1-3-8-6-9-4-5-10(15-2)7-11(9)14-12(8)13/h4-7H,3H2,1-2H3
InChI key:InChIKey=CENAQQALKXXNEE-UHFFFAOYSA-N
SMILES:C(C)C1=CC2=C(C=C(OC)C=C2)N=C1Cl
Synonyms:- 2-Chloro-3-ethyl-7-methoxyquinoline
- Quinoline, 2-chloro-3-ethyl-7-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
