CAS 132118-61-7

2-Chloro-5-fluoro-3-methylquinoline

Description:

2-Chloro-5-fluoro-3-methylquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of chlorine and fluorine substituents at the 2 and 5 positions, respectively, along with a methyl group at the 3 position, contributes to its unique chemical properties. This compound is typically a pale yellow to light brown solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. It exhibits moderate stability under standard conditions but may undergo reactions typical of halogenated compounds, such as nucleophilic substitution. The presence of the halogen atoms can influence its reactivity and potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₁₀H₇ClFN

InChI: InChI=1S/C10H7ClFN/c1-6-5-7-8(12)3-2-4-9(7)13-10(6)11/h2-5H,1H3

InChI key: InChIKey=DUUHTALYRZHCRC-UHFFFAOYSA-N

SMILES: FC=1C2=C(N=C(Cl)C(C)=C2)C=CC1

Synonyms:

• 2-Chloro-5-fluoro-3-methylquinoline
• Quinoline, 2-chloro-5-fluoro-3-methyl-