CAS 132119-20-1
:Carbamic acid, [5-(4-fluorobenzoyl)-1-methyl-1H-benzimidazol-2-yl]-, methyl ester
Description:
Carbamic acid, [5-(4-fluorobenzoyl)-1-methyl-1H-benzimidazol-2-yl]-, methyl ester, identified by CAS number 132119-20-1, is a chemical compound that features a benzimidazole core substituted with a 4-fluorobenzoyl group and a methyl ester functional group. This compound exhibits characteristics typical of carbamic acids, including the ability to form hydrogen bonds due to the presence of the carbamate functional group. The fluorobenzoyl substitution may enhance lipophilicity and influence the compound's biological activity, potentially making it relevant in pharmaceutical applications. The presence of the methyl ester suggests that it may undergo hydrolysis to release the corresponding acid, which can affect its reactivity and solubility in various solvents. Additionally, the structural complexity of this compound may contribute to its unique chemical properties, including stability and reactivity under specific conditions. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields.
Formula:C17H14FN3O3
InChI:InChI=1S/C17H14FN3O3/c1-21-14-8-5-11(15(22)10-3-6-12(18)7-4-10)9-13(14)19-16(21)20-17(23)24-2/h3-9H,1-2H3,(H,19,20,23)
InChI key:InChIKey=NNLLDAJLQCHALY-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1NC(OC)=O)=CC(C(=O)C3=CC=C(F)C=C3)=CC2
Synonyms:- Carbamic acid, [5-(4-fluorobenzoyl)-1-methyl-1H-benzimidazol-2-yl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Flubendazole EP Impurity F
CAS:Formula:C17H14FN3O3Color and Shape:White To Off-White SolidMolecular weight:327.32


