CAS 132127-34-5
:(3R,4S)-3-Hydroxy-4-phenyl-2-azetidinone
Description:
(3R,4S)-3-Hydroxy-4-phenyl-2-azetidinone, with the CAS number 132127-34-5, is a chiral compound characterized by its azetidinone structure, which includes a four-membered lactam ring. This compound features a hydroxyl group at the 3-position and a phenyl group at the 4-position, contributing to its unique chemical properties and potential biological activity. The stereochemistry indicated by the (3R,4S) designation suggests specific spatial arrangements of its substituents, which can significantly influence its reactivity and interactions with biological targets. As a result, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, (3R,4S)-3-Hydroxy-4-phenyl-2-azetidinone represents a valuable structure for further research in organic synthesis and potential therapeutic applications.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c11-8-7(10-9(8)12)6-4-2-1-3-5-6/h1-5,7-8,11H,(H,10,12)/t7-,8+/m0/s1
Synonyms:- (3R-Cis)-3-Hydroxy-4-Phenyl-2-Azetidinone
- Cis-3-Hydroxy-4-Phenyl-2-Azetidinone
- (3R,4S)-3-Hydroxy-4-Phenylazetidin-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Azetidinone, 3-hydroxy-4-phenyl-, (3R,4S)-
CAS:Formula:C9H9NO2Purity:97%Color and Shape:SolidMolecular weight:163.1733(3R,4S)-3-Hydroxy-4-Phenyl-2-Azetidinone
CAS:(3R,4S)-3-Hydroxy-4-Phenyl-2-AzetidinonePurity:99%Molecular weight:163.17g/mol(3R,4S)-3-Hydroxy-4-phenyl-2-azetidinone
CAS:Formula:C9H9NO2Purity:>98.0%(HPLC)(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:163.18(3R,4S)-3-Hydroxy-4-phenylazetidin-2-one
CAS:Formula:C9H9NO2Purity:97%Color and Shape:Liquid, No data available.Molecular weight:163.176(3R,4S)-3-Hydroxy-4-phenyl-2-azetidinone
CAS:Controlled ProductApplications Docetaxel or Paclitaxel intermediate.
References Newton, G., et al.: Biochem. J., 62, 651 (1956), Finke, P., et al.: J. Med. Chem., 38, 2449 (1995), Mascaretti, O., et al.: Curr. Med. Chem., 1, 441 (1995), Ogilvie, W., et al.: Bioorg Med. Chem., 7, 1521 (1999),Formula:C9H9NO2Color and Shape:NeatMolecular weight:163.17






