CAS 13213-36-0
:PHENYLACETONE OXIME
Description:
Phenylacetone oxime, with the CAS number 13213-36-0, is an organic compound characterized by the presence of both a phenyl group and an oxime functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. This compound is known for its role as an intermediate in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents, while being less soluble in water. Phenylacetone oxime can participate in various chemical reactions, including condensation and rearrangement, making it a versatile building block in synthetic chemistry. Additionally, it may possess specific reactivity due to the oxime functional group, which can undergo hydrolysis or participate in nucleophilic reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c1-8(10-11)7-9-5-3-2-4-6-9/h2-6,11H,7H2,1H3/b10-8+
Synonyms:- 1-Phenyl-2-propanone oxime
- Nsc 14435
- Phenylacetone ketoxime
- 2-Propanone, 1-phenyl-, oxime (8CI)(9CI)
- (2E)-1-phenylpropan-2-one oxime
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Phenylacetone oxime
CAS:Phenylacetone oxime is a chemical intermediate that can be used in the synthesis of pharmaceuticals. It has a neutral pH and is stable in the presence of alkalis, acids, oxidizing agents, and reducing agents. Phenylacetone oxime reacts with hydrogen chloride to form 1-chloro-2-phenylethanone and 2-chloroethanol. The reaction mechanism is as follows:
Formula:C9H11NOPurity:Min. 95%Color and Shape:PowderMolecular weight:149.19 g/molRef: 3D-FP66449
Discontinued product

