CAS 132131-24-9

2-Amino-5-iodobenzonitrile

Description:

2-Amino-5-iodobenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), an iodine atom, and a nitrile group (-C≡N) attached to a benzene ring. This compound features a benzene ring substituted at the 2-position with an amino group and at the 5-position with an iodine atom, along with a nitrile group at the 1-position. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The iodine atom contributes to its reactivity, particularly in electrophilic aromatic substitution reactions. The nitrile group adds to the compound's polarity and can participate in further chemical transformations. 2-Amino-5-iodobenzonitrile is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. Safety precautions should be taken when handling this substance due to the presence of iodine and its potential biological activity.

Formula: C₇H₅IN₂

InChI: InChI=1S/C7H5IN2/c8-6-1-2-7(10)5(3-6)4-9/h1-3H,10H2

InChI key: InChIKey=PRIOKVMBFXTMRV-UHFFFAOYSA-N

SMILES: C(#N)C1=C(N)C=CC(I)=C1

Synonyms:

• 2-Amino-5-Iodobenzonitrile
• 2-Cyano-4-iodoaniline
• Benzonitrile, 2-amino-5-iodo-

Benzonitrile, 2-amino-5-iodo-

CAS: 132131-24-9

Formula: C₇H₅IN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 244.0325

Ref: IN-DA00109J

2-Amino-5-iodobenzonitrile

CAS: 132131-24-9

2-Amino-5-iodobenzonitrile

Purity: 97%

Molecular weight: 244.03g/mol

Ref: 54-OR1010282

2-Amino-5-iodobenzonitrile

CAS: 132131-24-9

Formula: C₇H₅IN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 244.035

Ref: 10-F035134