CymitQuimica logo

CAS 13214-58-9

:

1-Fluoro-1,1-dinitroethane

Description:
1-Fluoro-1,1-dinitroethane, with the CAS number 13214-58-9, is a chemical compound characterized by its unique structure, which includes a fluorine atom and two nitro groups attached to an ethane backbone. This compound is typically a colorless to pale yellow liquid, exhibiting a relatively high density compared to water. It is known for its stability under standard conditions but can be reactive under certain circumstances, particularly in the presence of strong reducing agents or heat. The presence of nitro groups contributes to its potential as an energetic material, making it of interest in both industrial applications and research contexts. Additionally, 1-fluoro-1,1-dinitroethane may exhibit polar characteristics due to the electronegative fluorine and nitro groups, influencing its solubility in various solvents. Safety precautions are essential when handling this compound, as it may pose health risks through inhalation or skin contact, and it should be stored away from incompatible materials.
Formula:C2H3FN2O4
InChI:InChI=1/C2H3FN2O4/c1-2(3,4(6)7)5(8)9/h1H3
SMILES:CC(F)(N(=O)=O)N(=O)=O
Synonyms:
  • 1-Fluoro-1,1-dinitroethane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.