CAS 13215-35-5

β-Chloroalanine

Description:

β-Chloroalanine is an amino acid derivative characterized by the presence of a chlorine atom at the beta position relative to the amino group. Its chemical formula is C3H6ClN, and it features both an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids. This compound is a white crystalline solid that is soluble in water, reflecting its polar nature due to the functional groups present. β-Chloroalanine is known to be a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. It can act as an analog of alanine and may participate in various biochemical pathways, potentially influencing metabolic processes. The presence of the chlorine atom can impart unique reactivity, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, β-Chloroalanine has been studied for its potential role in biological systems, including its effects on neurotransmitter synthesis and its use in research related to neurochemistry.

Formula: C₃H₆ClNO₂

InChI: InChI=1S/C3H6ClNO2/c4-1-2(5)3(6)7/h2H,1,5H2,(H,6,7)

InChI key: InChIKey=ASBJGPTTYPEMLP-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CCl)N

Synonyms:

• Alanine, 3-chloro-
• 3-Chloroalanine
• DL-3-Chloroalanine
• β-Chloro-DL-alanine
• β-Chloroalanine