CAS 132150-13-1
:13-hydroxyglucopiericidin A
Description:
13-Hydroxyglucopiericidin A is a chemical compound that belongs to the class of natural products known as alkaloids, specifically derived from certain fungi. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. The presence of a hydroxyl group at the 13th position is significant, as it can influence the compound's solubility, reactivity, and interaction with biological targets. This compound is often studied for its potential pharmacological properties, including antimicrobial and anticancer activities. Its unique structure may also allow for specific interactions with enzymes or receptors in biological systems, making it a subject of interest in medicinal chemistry. The compound's CAS number, 132150-13-1, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields. Overall, 13-hydroxyglucopiericidin A exemplifies the intricate relationship between chemical structure and biological function in natural products.
Formula:C31H47NO10
InChI:InChI=1/C31H47NO10/c1-17(11-12-22-21(5)24(35)29(39-6)30(32-22)40-7)9-8-10-18(2)15-20(4)28(19(3)13-14-33)42-31-27(38)26(37)25(36)23(16-34)41-31/h8,10-11,13,15,20,23,25-28,31,33-34,36-38H,9,12,14,16H2,1-7H3,(H,32,35)/b10-8-,17-11-,18-15-,19-13-/t20-,23-,25-,26+,27-,28+,31+/m1/s1
Synonyms:- β-D-Glucopyranoside, 10-(4-hydroxy-5,6-dimethoxy-3-methyl-2-pyridinyl)-1-(3-hydroxy-1-methyl-1-propenyl)-2,4,8-trimethyl-3,5,8-decatrienyl, [R-[R*,R*-(all-E)]]- (9CI)
- 13-hydroxyglucopiericidin A
- 2-[(2Z,5Z,7Z,9R,10R,11Z)-13-hydroxy-3,7,9,11-tetramethyl-10-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytrideca-2,5,7,11-tetraenyl]-5,6-dimethoxy-3-methyl-1H-pyridin-4-one
- (1R,2R,3Z,5Z,8Z)-10-(5,6-dimethoxy-3-methyl-4-oxo-1,4-dihydropyridin-2-yl)-1-[(1Z)-3-hydroxy-1-methylprop-1-en-1-yl]-2,4,8-trimethyldeca-3,5,8-trien-1-yl beta-D-glucopyranoside
- 13-Hydroxyglucopiericidin A
- beta-D-Glucopyranoside, 10-(4-hydroxy-5,6-dimethoxy-3-methyl-2-pyridinyl)-1-(3-hydroxy-1-methyl-1-propenyl)-2,4,8-trimethyl-3,5,8-decatrienyl, (R-(R*,R*(all-E)))-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
13-Hydroxyglucopiericidin A
CAS:<p>13-Hydroxyglucopiericidin A is an antibiotic with potent antitumor cell activity.</p>Formula:C31H47NO10Color and Shape:SolidMolecular weight:593.706
