
CAS 1321518-37-9
:2-Cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
2-Cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a cyclopropyl group and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The compound's molecular structure contributes to its potential reactivity and stability, influenced by the electron-withdrawing nature of the pyridine nitrogen and the steric bulk of the tetramethyl dioxaborolane. Additionally, the cyclopropyl group can impart unique strain-related properties, affecting the compound's overall reactivity and interaction with other chemical species. This compound may exhibit interesting biological activities or serve as a building block in the synthesis of more complex molecules, making it of interest in medicinal chemistry and materials science. Its specific properties, such as solubility, melting point, and reactivity, would depend on the conditions under which it is studied.
Formula:C14H20BNO2
InChI:InChI=1S/C14H20BNO2/c1-13(2)14(3,4)18-15(17-13)11-7-8-16-12(9-11)10-5-6-10/h7-10H,5-6H2,1-4H3
InChI key:InChIKey=QQJFOGNRVVXBAV-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(N=CC2)C3CC3
Synonyms:- 2-Cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
- Pyridine, 2-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.