CAS 1321518-38-0

6-Oxa-9-azaspiro[4.5]decane, hydrochloride (1:1)

Description:

6-Oxa-9-azaspiro[4.5]decane, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which consists of a nitrogen atom and an oxygen atom incorporated into a bicyclic framework. This compound features a spiro connection between two rings, contributing to its three-dimensional conformation, which can influence its biological activity and interactions. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it more suitable for pharmaceutical applications. Typically, compounds of this nature may exhibit properties such as potential neuroactivity or other pharmacological effects, although specific biological activities would depend on further empirical studies. The presence of both nitrogen and oxygen in the structure suggests potential for hydrogen bonding, which can affect its reactivity and interactions with other molecules. As with many chemical substances, safety and handling precautions are essential, particularly in laboratory settings, due to potential toxicity or reactivity.

Formula: C₈H₁₅NO·ClH

InChI: InChI=1S/C8H15NO.ClH/c1-2-4-8(3-1)7-9-5-6-10-8;/h9H,1-7H2;1H

InChI key: InChIKey=DLANBMNXKUHFJO-UHFFFAOYSA-N

SMILES: C12(CNCCO1)CCCC2.Cl

Synonyms:

• 6-Oxa-9-azaspiro[4.5]decane, hydrochloride (1:1)

6-oxa-9-azaspiro[4.5]decane hydrochloride

CAS: 1321518-38-0

Formula: C₈H₁₆ClNO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 177.67

Ref: 10-F385937