CAS 132152-76-2
:2-ACETAMIDO-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE
Description:
2-Acetamido-2-deoxy-D-gluconhydroximo-1,5-lactone is a chemical compound characterized by its structural features that include an acetamido group, a deoxy sugar moiety, and a lactone ring. This compound is derived from D-glucose and exhibits properties typical of amino sugars, which often play significant roles in biological systems, particularly in glycoprotein and glycolipid synthesis. The presence of the hydroximo group suggests potential reactivity, particularly in coordination with metal ions or in forming chelates. The lactone structure indicates that it can exist in a cyclic form, which may influence its stability and reactivity. This compound may be of interest in medicinal chemistry and biochemistry due to its potential applications in drug development or as a biochemical probe. Its specific interactions and biological activities would depend on its conformation and the functional groups present, making it a subject for further research in the context of its pharmacological properties and mechanisms of action.
Formula:C8H14N2O6
InChI:InChI=1/C8H14N2O6/c1-3(12)9-5-7(14)6(13)4(2-11)16-8(5)10-15/h4-7,11,13-15H,2H2,1H3,(H,9,12)/t4?,5?,6-,7?/m1/s1
SMILES:CC(=NC1C([C@@H](C(CO)OC1=NO)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Acetamido-2-deoxy-D-gluconhydroximo-1,5-lactone
CAS:<p>2-Acetamido-2-deoxy-D-gluconhydroximo-1,5-lactone is a farnesyltransferase inhibitor that belongs to the group of techniques. It is used in the diagnosis of relapsed and resistant multiple myeloma. This drug has been shown to be a potent inductor of apoptosis in vitro and in vivo through inhibition of protein synthesis. 2-Acetamido-2-deoxy-D-gluconhydroximo-1,5-lactone also inhibits the growth of tumor cells and can be used as a potential chemotherapeutic agent for pediatric patients with relapsed or resistant myeloma.</p>Formula:C8H14N2O6Purity:Min. 95%Molecular weight:234.21 g/mol
