
CAS 1321600-77-4
:4-[(4-Acetyl-1-piperazinyl)methyl]-N-[4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]benzamide
Description:
The chemical substance known as 4-[(4-Acetyl-1-piperazinyl)methyl]-N-[4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]benzamide, with the CAS number 1321600-77-4, is a complex organic compound characterized by its multi-functional structure. It features a piperazine ring, which is a common motif in pharmacologically active compounds, contributing to its potential biological activity. The presence of acetyl and methyl groups suggests that it may exhibit lipophilic properties, enhancing its ability to permeate biological membranes. Additionally, the compound contains a pyrimidine and pyridine moiety, which are often associated with various pharmacological effects, including anti-cancer and anti-inflammatory activities. The amide functional group indicates potential for hydrogen bonding, which may influence its solubility and interaction with biological targets. Overall, this compound's intricate structure suggests it may be of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C30H31N7O2
InChI:InChI=1S/C30H31N7O2/c1-21-5-10-26(18-28(21)35-30-32-13-11-27(34-30)25-4-3-12-31-19-25)33-29(39)24-8-6-23(7-9-24)20-36-14-16-37(17-15-36)22(2)38/h3-13,18-19H,14-17,20H2,1-2H3,(H,33,39)(H,32,34,35)
InChI key:InChIKey=HCSSWFKULPRADJ-UHFFFAOYSA-N
SMILES:N(C=1N=C(C=CN1)C=2C=CC=NC2)C3=CC(NC(=O)C4=CC=C(CN5CCN(C(C)=O)CC5)C=C4)=CC=C3C
Synonyms:- Benzamide, 4-[(4-acetyl-1-piperazinyl)methyl]-N-[4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]-
- 4-[(4-Acetyl-1-piperazinyl)methyl]-N-[4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-[(4-Acetyl-1-piperazinyl)methyl]-N-[4-methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]benzamide
CAS:Controlled ProductFormula:C30H31N7O2Color and Shape:Light Yellow To YellowMolecular weight:521.61

