CAS 132183-78-9

5H-Dibenz[b,f]azepine-1,2,3,4,6,7,8,9,10,11-d10-5-carboxamide

Description:

5H-Dibenz[b,f]azepine-1,2,3,4,6,7,8,9,10,11-d10-5-carboxamide is a chemical compound characterized by its complex polycyclic structure, which includes a dibenzazepine core. This compound is isotopically labeled with deuterium, indicated by the "d10" in its name, suggesting that ten hydrogen atoms in the structure have been replaced with deuterium, a heavier isotope of hydrogen. This labeling is often used in research to trace metabolic pathways or to study reaction mechanisms. The carboxamide functional group contributes to its potential solubility and reactivity, making it relevant in medicinal chemistry and pharmacology. The compound may exhibit specific biological activities, which can be influenced by its structural features, including the arrangement of the aromatic rings and the presence of the carboxamide group. Its CAS number, 132183-78-9, allows for precise identification in chemical databases and literature. Overall, this compound's unique structure and isotopic labeling make it a valuable subject for various scientific investigations.

Formula: C₁₅H₂D₁₀N₂O

InChI: InChI=1S/C15H12N2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H,(H2,16,18)/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D

InChI key: InChIKey=FFGPTBGBLSHEPO-LHNTUAQVSA-N

SMILES: C(N)(=O)N1C=2C(=C(C(=C(C2[2H])[2H])[2H])[2H])C(=C(C=3C1=C(C(=C(C3[2H])[2H])[2H])[2H])[2H])[2H]

Synonyms:

• 5H-Dibenz[b,f]azepine-1,2,3,4,6,7,8,9,10,11-d10-5-carboxamide

Carbamazepine-d10

CAS: 132183-78-9

Formula: C₁₅H₂D₁₀N₂O

Color and Shape: White To Off-White Solid

Molecular weight: 246.34

Ref: 4Z-C-191

Carbamazepine-d10 (rings-d10)

CAS: 132183-78-9

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 246.33

Ref: 3U-D3542

Carbamezepine-D10

Controlled Product

CAS: 132183-78-9

Applications Carbamazepine-D10 is used to study occurrence of emerging trace organic chemicals in wastewater effluents in Saudi Arabia.
References Alidina, M., et al.: Sci. Total Environ., 478, 152 (2014);

Formula: C₁₅₂H₁₀H₂N₂O

Color and Shape: Neat

Molecular weight: 246.33

Ref: TR-C175851

CARBAMAZEPINE-D10

CAS: 132183-78-9

Formula: C₁₅H₂D₁₀N₂O

Purity: 99%

Color and Shape: Solid

Molecular weight: 246.3302

Ref: IN-DA009BW3