CAS 132185-84-3
:5β-Hydroxycostic acid
Description:
5β-Hydroxycostic acid, identified by its CAS number 132185-84-3, is a chemical compound that belongs to the class of steroid derivatives. It is characterized by the presence of a hydroxyl group at the 5β position of the steroid nucleus, which influences its biological activity and solubility. This compound is typically derived from natural sources, particularly from certain plants, and is known for its potential pharmacological properties. It may exhibit anti-inflammatory, analgesic, or other therapeutic effects, although specific biological activities can vary based on structural modifications and the context of use. The compound's molecular structure contributes to its interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, its stability, solubility, and reactivity can be influenced by environmental factors and the presence of other functional groups. As with many steroid derivatives, the study of 5β-Hydroxycostic acid may provide insights into its potential applications in drug development and therapeutic interventions.
Formula:C15H22O3
InChI:InChI=1S/C15H22O3/c1-10-5-4-7-14(3)8-6-12(9-15(10,14)18)11(2)13(16)17/h12,18H,1-2,4-9H2,3H3,(H,16,17)/t12-,14-,15+/m1/s1
InChI key:InChIKey=UEQIFFFWXPAQCB-YUELXQCFSA-N
SMILES:O[C@@]12[C@@](C)(CC[C@@H](C(C(O)=O)=C)C1)CCCC2=C
Synonyms:- 5β-Hydroxycostic acid
- 2-Naphthaleneacetic acid, decahydro-8a-hydroxy-4a-methyl-α,8-bis(methylene)-, [2R-(2α,4aα,8aα)]-
- 2-Naphthaleneacetic acid, decahydro-8a-hydroxy-4a-methyl-α,8-bis(methylene)-, (2R,4aR,8aS)-
- (2R,4aR,8aS)-Decahydro-8a-hydroxy-4a-methyl-α,8-bis(methylene)-2-naphthaleneacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R,4aR,8aS)-Decahydro-8a-hydroxy-4a-methyl-α,8-bis(methylene)-2-naphthaleneacetic acid
CAS:Formula:C15H22O3Purity:93.0%Molecular weight:250.33345β-Hydroxycostic acid
CAS:5beta-Hydroxycostic acid is a natural product for research related to life sciences. The catalog number is TN3140 and the CAS number is 132185-84-3.Formula:C15H22O3Purity:98%Color and Shape:SolidMolecular weight:250.335β-Hydroxycostic acid
CAS:Formula:C15H22O3Purity:95%~99%Color and Shape:PowderMolecular weight:250.338(2R,4aR,8aS)-Decahydro-8a-hydroxy-4a-methyl-α,8-bis(methylene)-2-naphthaleneacetic acid
CAS:Controlled ProductApplications (2R,4aR,8aS)-Decahydro-8a-hydroxy-4a-methyl-α,8-bis(methylene)-2-naphthaleneacetic acid is extracted from the roots of Saussurea lappa, and Laggera pterodonta, may have anti-viral properties and used in traditional chinese medicine.
References Wang, Yu, et al.: BMC Complementary and Alternative Medicine, 17, 25 (2017); Zhang, T. et al.: Zhongguo Zhongyao Zazhi, 36, 1620 (2011);Formula:C15H22O3Color and Shape:NeatMolecular weight:250.3335β-Hydroxycostic acid
CAS:5β-Hydroxycostic acid is a diterpenoid compound, which is primarily isolated from plant sources, particularly those in the family Asteraceae. This compound belongs to a class of secondary metabolites known for their diverse and significant biological activities. As a naturally occurring chemical, 5β-Hydroxycostic acid is biosynthesized within the plant tissues and can be extracted through various chromatographic techniques.Formula:C15H22O3Purity:Min. 95%Molecular weight:250.33 g/mol




