CAS 132194-21-9

[(2S,5R)-5-(2-amino-6-fluoro-9H-purin-9-yl)tetrahydrofuran-2-yl]methanol

Description:

The chemical substance with the name "[(2S,5R)-5-(2-amino-6-fluoro-9H-purin-9-yl)tetrahydrofuran-2-yl]methanol" and CAS number 132194-21-9 is a purine derivative that exhibits characteristics typical of nucleoside analogs. This compound features a tetrahydrofuran ring, which contributes to its structural complexity and potential biological activity. The presence of a fluorine atom and an amino group suggests that it may interact with biological systems, possibly influencing nucleic acid metabolism or serving as an antiviral agent. Its stereochemistry, indicated by the (2S,5R) configuration, is crucial for its biological function, as stereoisomers can exhibit significantly different pharmacological properties. The methanol moiety may enhance solubility and stability in biological environments. Overall, this compound is of interest in medicinal chemistry, particularly in the development of therapeutics targeting viral infections or cancer, due to its structural similarity to naturally occurring nucleosides. Further studies would be necessary to elucidate its specific mechanisms of action and therapeutic potential.

Formula: C₁₀H₁₂FN₅O₂

InChI: InChI=1/C10H12FN5O2/c11-8-7-9(15-10(12)14-8)16(4-13-7)6-2-1-5(3-17)18-6/h4-6,17H,1-3H2,(H2,12,14,15)/t5-,6+/m0/s1

Synonyms:

• 2-Amino-6-fluoro-9-(2,3-dideoxy-.beta.-D-glycero-pentofuranosyl)-9H-purine
• 2-furanmethanol, 5-(2-amino-6-fluoro-9H-purin-9-yl)tetrahydro-, (2S,5R)-