CAS 132194-24-2
:[(2S,5R)-5-(6-fluoro-9H-purin-9-yl)tetrahydrofuran-2-yl]methanol
Description:
The chemical substance with the name "[(2S,5R)-5-(6-fluoro-9H-purin-9-yl)tetrahydrofuran-2-yl]methanol" and CAS number 132194-24-2 is a purine derivative characterized by its unique structural features. It contains a tetrahydrofuran ring, which contributes to its cyclic structure, and a methanol group that enhances its reactivity and solubility in polar solvents. The presence of a fluorine atom at the 6-position of the purine moiety may influence its biological activity and stability, potentially affecting interactions with biological targets. This compound is likely to exhibit properties typical of nucleoside analogs, which can include antiviral or anticancer activities, depending on its specific interactions within biological systems. Its stereochemistry, indicated by the (2S,5R) configuration, suggests that it may have specific spatial orientations that are crucial for its biological function. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents.
Formula:C10H11FN4O2
InChI:InChI=1/C10H11FN4O2/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(3-16)17-7/h4-7,16H,1-3H2/t6-,7+/m0/s1
Synonyms:- 2-furanmethanol, 5-(6-fluoro-9H-purin-9-yl)tetrahydro-, (2S,5R)-
- 6-Fluoro-9-(2,3-dideoxy-.beta.-D-glycero-pentofuranosyl)-9H-purine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.