CAS 132194-28-6
:2',3'-Dideoxyxanthosine
Description:
2',3'-Dideoxyxanthosine is a nucleoside analog characterized by the absence of hydroxyl groups at the 2' and 3' positions of the ribose sugar moiety, which distinguishes it from standard ribonucleosides. This structural modification imparts unique properties, making it a subject of interest in medicinal chemistry, particularly in antiviral and anticancer research. The compound is derived from xanthine, a purine base, and is typically involved in the inhibition of nucleic acid synthesis. Its mechanism of action often involves interference with viral replication processes, making it a potential therapeutic agent against certain viral infections. Additionally, the lack of hydroxyl groups contributes to its stability and bioavailability in biological systems. The compound's pharmacological profile, including its efficacy and toxicity, is an area of ongoing research, as understanding these characteristics is crucial for its application in clinical settings. Overall, 2',3'-Dideoxyxanthosine represents a significant compound in the study of nucleoside analogs and their therapeutic potential.
Formula:C10H12N4O4
InChI:InChI=1/C10H12N4O4/c15-3-5-1-2-6(18-5)14-4-11-7-8(14)12-10(17)13-9(7)16/h4-6,15H,1-3H2,(H2,12,13,16,17)/t5-,6+/m0/s1
Synonyms:- 9-[(2R,5S)-5-(Hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione
- 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-3,9-dihydro-1H-purine-2,6-dione
- Xanthosine, 2',3'-dideoxy-
- 2',3'-Dideoxyxanthosine
- Aids002850
- Aids-002850
- Xanthosine, 2',3'-dideoxy- (9CI)
- 9-(2,3-Dideoxy-.beta.-D-glycero-pentofuranosyl)-9H-xanthosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2',3'-Dideoxyxanthosine
CAS:Controlled Product<p>2',3'-Dideoxyxanthosine is a purine nucleoside analog that inhibits the production of human immunodeficiency virus (HIV). It has potent activity against HIV and is more potent than other drugs in its class. This drug also inhibits the growth of cells by preventing the synthesis of DNA, RNA, and proteins. 2',3'-Dideoxyxanthosine has shown to be an effective treatment for HIV infection.</p>Formula:C10H12N4O4Purity:Min. 95%Molecular weight:252.23 g/mol

