CAS 13220-27-4

1-Methylpyrrolidin-3-amine

Description:

1-Methylpyrrolidin-3-amine, also known as N-methyl-3-pyrrolidinamine, is an organic compound characterized by a pyrrolidine ring with a methyl group and an amine functional group. It has a molecular structure that includes a five-membered nitrogen-containing ring, which contributes to its basicity and potential reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of the amine group allows it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. 1-Methylpyrrolidin-3-amine is of interest in medicinal chemistry and may be explored for its potential biological activities, including effects on neurotransmitter systems. However, safety and handling precautions are essential, as amines can be hazardous. As with any chemical substance, proper characterization and understanding of its properties are crucial for its application in research and industry.

Formula: C₅H₁₂N₂

InChI: InChI=1/C5H12N2/c1-7-3-2-5(6)4-7/h5H,2-4,6H2,1H3

SMILES: CN1CCC(C1)N

Synonyms:

• 1-Methyl-pyrrolidin-3-ylamine
• 3-Pyrrolidinamine, 1-methyl-

3-Pyrrolidinamine, 1-methyl-

CAS: 13220-27-4

Formula: C₅H₁₂N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 100.1622

Ref: IN-DA0010CW

1-Methylpyrrolidin-3-amine

CAS: 13220-27-4

1-Methylpyrrolidin-3-amine

Purity: 95%

Molecular weight: 100.16g/mol

Ref: 54-OR308139

1-Methylpyrrolidin-3-amine

CAS: 13220-27-4

Formula: C₅H₁₂N₂

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 100.165

Ref: 10-F093541