CAS 132203-79-3
:(2S,3S)-2,3-Bis(hydroxymethyl)cyclobutanone
Description:
(2S,3S)-2,3-Bis(hydroxymethyl)cyclobutanone is a cyclic ketone characterized by its four-membered ring structure, which includes two hydroxymethyl groups attached to the second and third carbon atoms of the cyclobutane ring. This compound exhibits chirality due to the presence of stereocenters at the 2 and 3 positions, resulting in specific optical isomers. The hydroxymethyl groups contribute to its hydrophilicity, enhancing its solubility in polar solvents. As a ketone, it features a carbonyl group (C=O), which is reactive and can participate in various chemical reactions, such as nucleophilic additions. The presence of hydroxymethyl groups also allows for potential hydrogen bonding, influencing its physical properties, such as boiling and melting points. This compound may have applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. Its unique structure and functional groups make it a subject of interest for further research in various chemical fields.
Formula:C6H10O3
InChI:InChI=1S/C6H10O3/c7-2-4-1-6(9)5(4)3-8/h4-5,7-8H,1-3H2/t4-,5-/m1/s1
InChI key:InChIKey=ZSLPKLFDMZHAFT-RFZPGFLSSA-N
SMILES:C(O)[C@@H]1[C@@H](CO)C(=O)C1
Synonyms:- (2S,3S)-2,3-Bis(hydroxymethyl)cyclobutanone
- Cyclobutanone, 2,3-bis(hydroxymethyl)-, (2S,3S)-
- Cyclobutanone, 2,3-bis(hydroxymethyl)-, (2S-trans)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
