CAS 13221-71-1
:1,1,2,3,3,4-HEXAFLUORO-2,4-BIS(TRIFLUOROMETHYL)CYCLOBUTANE
Description:
1,1,2,3,3,4-Hexafluoro-2,4-bis(trifluoromethyl)cyclobutane, with CAS number 13221-71-1, is a fluorinated organic compound characterized by its unique structure, which includes a cyclobutane ring substituted with multiple trifluoromethyl groups and fluorine atoms. This compound is notable for its high degree of fluorination, which imparts significant chemical stability and low reactivity, making it resistant to degradation under various conditions. Its physical properties typically include a low boiling point and high density, common among perfluorinated compounds. The presence of multiple fluorine atoms contributes to its non-polar characteristics, resulting in low solubility in water but good solubility in organic solvents. Additionally, due to its fluorinated nature, it exhibits low surface tension and is often used in applications requiring chemical inertness, such as in specialty lubricants, refrigerants, or as a solvent in various chemical processes. Safety considerations are paramount, as fluorinated compounds can pose environmental and health risks, necessitating careful handling and disposal.
Formula:C6F12
InChI:InChI=1/C6F12/c7-1(5(13,14)15)3(9,10)2(8,4(1,11)12)6(16,17)18
InChI key:InChIKey=WEQNAYAFSPIONP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(F)C(F)(F)C(C(F)(F)F)(F)C1(F)F
Synonyms:- Cyclobutane, 1,1,2,3,3,4-hexafluoro-2,4-bis(trifluoromethyl)-
- Cyclobutane, hexafluoro-1,3-bis(trifluoromethyl)-
- Hexafluoro-1,3-bis(trifluoromethyl)cyclobutane
- 1,1,2,3,3,4-Hexafluoro-2,4-bis(trifluoromethyl)cyclobutane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cyclobutane, 1,1,2,3,3,4-hexafluoro-2,4-bis(trifluoromethyl)-
CAS:Formula:C6F12Molecular weight:300.0451,1,2,3,3,4-Hexafluoro-2,4-Bis(Trifluoromethyl)Cyclobutane
CAS:Controlled Product1,1,2,3,3,4-Hexafluoro-2,4-Bis(trifluoromethyl)cyclobutane (HFCB) is a contaminant that is used in the production of polymers. HFCB is an example of a chiral molecule with two different structural isomers. It can be detected by gas chromatography and electron capture detection. HFCB has been shown to have analytical selectivity for substances such as 1-octene and ethylene glycol. The sensitivity of HFCB can be optimized using various experimental parameters including the type of detector used and the desorption temperature. This chemical has been studied extensively for its potential use in ion chemical analysis techniques such as ESI or APCI.Formula:C6F12Purity:Min. 95%Molecular weight:300.05 g/mol

