
CAS 13221-80-2
:2-Chloro-1-[4-(4-chlorophenoxy)phenyl]ethanone
Description:
2-Chloro-1-[4-(4-chlorophenoxy)phenyl]ethanone, with the CAS number 13221-80-2, is an organic compound characterized by its complex structure, which includes a chloro group and a phenoxy moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chloro substituent enhances its reactivity, making it useful in synthetic organic chemistry. Its phenyl groups contribute to its hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. The compound may exhibit biological activity, which is often assessed through various assays to determine its efficacy and safety in potential applications. As with many chlorinated compounds, it is essential to handle it with care due to possible toxicity and environmental concerns. Proper safety measures, including the use of personal protective equipment and adherence to regulatory guidelines, are crucial when working with this substance in laboratory or industrial settings.
Formula:C14H10Cl2O2
InChI:InChI=1S/C14H10Cl2O2/c15-9-14(17)10-1-5-12(6-2-10)18-13-7-3-11(16)4-8-13/h1-8H,9H2
InChI key:InChIKey=UASGQUAGMKEZDJ-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(CCl)=O)C=C1)C2=CC=C(Cl)C=C2
Synonyms:- 2-Chloro-1-[4-(4-chlorophenoxy)phenyl]ethanone
- 4-(Chloroacetyl)-4′-chlorodiphenyl ether
- Acetophenone, 2-chloro-4′-(p-chlorophenoxy)-
- Ethanone, 2-chloro-1-[4-(4-chlorophenoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
