CAS 13221-89-1
:3-Piperidinecarboxylic acid, 1-methyl-4-oxo-, methyl ester
Description:
3-Piperidinecarboxylic acid, 1-methyl-4-oxo-, methyl ester, also known by its CAS number 13221-89-1, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The presence of a ketone group (4-oxo) indicates that there is a carbonyl group adjacent to the nitrogen atom in the piperidine ring. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in pharmaceutical research. The molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of compounds with therapeutic properties. As with many piperidine derivatives, it may also serve as a building block for synthesizing more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H13NO3
InChI:InChI=1S/C8H13NO3/c1-9-4-3-7(10)6(5-9)8(11)12-2/h6H,3-5H2,1-2H3
InChI key:InChIKey=BKCOINBLEJIZGR-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(=O)CCN(C)C1
Synonyms:- 1-Methyl-3-carbomethoxy-4-piperidinone
- 1-Methyl-3-methoxycarbonylpiperidin-4-one
- 1-Methyl-4-Oxo-3-Piperidinecarboxylate
- 1-Methyl-4-oxo-3-piperidinecarboxylic acid methyl ester
- 3-Carbomethoxy-N-methyl-4-piperidinone
- 3-Methoxycarbonyl-1-Methyl-4-Piperidone
- 3-Piperidinecarboxylic acid, 1-methyl-4-oxo-, methyl ester
- Methyl 1-methyl-4-oxo-3-piperidine carboxylate
- Methyl 1-methyl-4-oxo-3-piperidinecarboxylate
- N-Methyl-3-carbomethoxy-4-piperidinone
- Nipecotic acid, 1-methyl-4-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Methyl 1-Methyl-4-oxopiperidine-3-carboxylate
CAS:Controlled ProductFormula:C8H13NO3Color and Shape:NeatMolecular weight:171.19

