CAS 13221-94-8
:3-tert-butylpentane-2,4-dione
Description:
3-tert-butylpentane-2,4-dione, with the CAS number 13221-94-8, is an organic compound characterized by its diketone structure, featuring two carbonyl (C=O) groups located at the 2 and 4 positions of a pentane chain. The presence of a tert-butyl group at the 3-position contributes to its branched structure, influencing its physical and chemical properties. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic characteristics. 3-tert-butylpentane-2,4-dione can participate in various chemical reactions, including condensation and oxidation, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. Its reactivity is influenced by the electron-withdrawing nature of the carbonyl groups, which can stabilize carbanions formed during reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C9H16O2
InChI:InChI=1/C9H16O2/c1-6(10)8(7(2)11)9(3,4)5/h8H,1-5H3
SMILES:CC(=O)C(C(=O)C)C(C)(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(tert-Butyl)pentane-2,4-dione
CAS:<p>3-(tert-Butyl)pentane-2,4-dione</p>Formula:C9H16O2Purity:techColor and Shape:LiquidMolecular weight:156.22g/mol3-tert-Butylpentane-2,4-dione
CAS:<p>3-tert-Butylpentane-2,4-dione is a chemical compound that can be synthesized in two steps from benzene, nitromethane and perchloric acid. It is used as a precursor to produce polymers with different properties. In the first step of the synthesis, 3-tert-butylpentane-2,4-dione condenses with nitromethane to form an oligomer. The resulting product is then oxidized to form a perchlorate ester which yields polymers with different properties depending on the type of monomer used.</p>Formula:C9H16O2Purity:90%Molecular weight:156.22 g/mol


