CAS 132210-43-6
:Cipamfylline
Description:
Cipamfylline, with the CAS number 132210-43-6, is a chemical compound that belongs to the class of xanthine derivatives. It is primarily recognized for its potential use as a bronchodilator, which means it may help in the treatment of respiratory conditions by relaxing the muscles in the airways and improving airflow to the lungs. The compound exhibits properties that can influence the central nervous system and may have implications in various therapeutic areas. Cipamfylline is characterized by its ability to inhibit phosphodiesterase, leading to increased levels of cyclic AMP, which is crucial for various cellular processes. Its pharmacological profile suggests a moderate safety margin, but like many compounds, it may have side effects that need to be monitored during use. The substance is typically studied in the context of its efficacy and safety in clinical settings, particularly for conditions such as asthma or chronic obstructive pulmonary disease (COPD). Further research is essential to fully understand its mechanisms and potential applications in medicine.
Formula:C13H17N5O2
InChI:InChI=1S/C13H17N5O2/c14-12-15-9-10(16-12)17(5-7-1-2-7)13(20)18(11(9)19)6-8-3-4-8/h7-8H,1-6H2,(H3,14,15,16)
InChI key:InChIKey=KSPYMJJKQMWWNB-UHFFFAOYSA-N
SMILES:C(N1C2=C(C(=O)N(CC3CC3)C1=O)NC(N)=N2)C4CC4
Synonyms:- 1H-Purine-2,6-dione, 8-amino-1,3-bis(cyclopropylmethyl)-3,7-dihydro-
- 1H-Purine-2,6-dione, 8-amino-1,3-bis(cyclopropylmethyl)-3,9-dihydro-
- 8-Amino-1,3-bis(cyclopropylmethyl)-3,9-dihydro-1H-purine-2,6-dione
- 8-Amino-1,3-bis(cyclopropylmethyl)xanthine
- 8-amino-1,3-bis(cyclopropylmethyl)-3,7-dihydro-1H-purine-2,6-dione
- Brl 61063
- Cipamfylline [USAN:INN]
- Unii-Afp56R140L
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cipamfylline
CAS:Controlled ProductCipamfylline is a 2-adrenergic receptor antagonist and phosphodiesterase inhibitor. It inhibits the action of cyclic nucleotide phosphodiesterases and has been shown to have therapeutic effects in inflammatory bowel disease, bowel disease, and brain infarction. Cipamfylline binds to microbial fatty acid membranes, which may result in an increased production of cytokines that are involved in the induction of inflammatory responses. This drug has been shown to be effective in treatment trials for bacterial infections such as Mycoplasma pneumoniae, Chlamydia pneumoniae, Helicobacter pylori, Legionella pneumophila, Salmonella enterica serovar typhimurium, Listeria monocytogenes, and Staphylococcus aureus. Cipamfylline also has potential for use against viral infections such as herpes simplex virus type 1 (HSV-1) or Epstein-Barr virus (EBFormula:C13H17N5O2Purity:Min. 95%Molecular weight:275.31 g/molCipamfylline
CAS:Cipamfylline: PDE-4 inhibitor, theophylline analogue; treats atopic dermatitis better than placebo, less so than hydrocortisone-17-butyrate.Formula:C13H17N5O2Color and Shape:SolidMolecular weight:275.31

