CAS 132213-65-1

5-Methoxy-3,6-bis(phenylmethyl)-2(1H)-pyrazinone

Description:

5-Methoxy-3,6-bis(phenylmethyl)-2(1H)-pyrazinone is an organic compound characterized by its pyrazinone core, which features a methoxy group and two phenylmethyl substituents. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but its solubility in water is limited. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors or enzymes. The phenylmethyl groups contribute to its overall hydrophobic character, which may affect its pharmacokinetic properties. As a pyrazinone derivative, it may exhibit interesting chemical reactivity, including potential for tautomerism and participation in various organic reactions. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, although specific biological activities would require further investigation. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe laboratory practices.

Formula: C₁₉H₁₈N₂O₂

InChI: InChI=1S/C19H18N2O2/c1-23-19-17(13-15-10-6-3-7-11-15)20-18(22)16(21-19)12-14-8-4-2-5-9-14/h2-11H,12-13H2,1H3,(H,20,22)

InChI key: InChIKey=HDGSSKSUEFFBRK-UHFFFAOYSA-N

SMILES: C(C1=C(OC)N=C(CC2=CC=CC=C2)C(=O)N1)C3=CC=CC=C3

Synonyms:

• 5-Methoxy-3,6-bis(phenylmethyl)-2(1H)-pyrazinone
• 2(1H)-Pyrazinone, 5-methoxy-3,6-bis(phenylmethyl)-

2(1H)-Pyrazinone, 5-methoxy-3,6-bis(phenylmethyl)-

CAS: 132213-65-1

Formula: C₁₉H₁₈N₂O₂

Purity: 98.5%

Molecular weight: 306.3584

Ref: IN-DA01QP51

3,6-Dibenzyl-2-hydroxy-5-methoxypyrazine

CAS: 132213-65-1

3,6-Dibenzyl-2-hydroxy-5-methoxypyrazine is a natural product for research related to life sciences.

Formula: C₁₉H₁₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 306.36

Ref: TM-TN2905

3,6-Dibenzyl-2-hydroxy-5-methoxypyrazine

CAS: 132213-65-1

3,6-Dibenzyl-2-hydroxy-5-methoxypyrazine is a quorum sensing inhibitor, which is derived from the metabolic processes of certain Pseudomonas species. Its mode of action involves interfering with the signaling pathways that bacteria use for intra-species communication, specifically by disrupting the autoinducer molecules responsible for coordinating behaviors such as biofilm formation, virulence factor production, and bioluminescence.

Formula: C₁₉H₁₈N₂O₂

Purity: Min. 95%

Molecular weight: 306.4 g/mol

Ref: 3D-HFA21365