CAS 13222-16-7
:N,N′-1,6-Hexanediylbis[2-ethylhexanamide]
Description:
N,N′-1,6-Hexanediylbis[2-ethylhexanamide], with CAS number 13222-16-7, is an organic compound characterized by its amide functional groups and a hexanediyl chain. This substance features two 2-ethylhexanamide moieties connected by a hexane backbone, which contributes to its unique properties. It is typically a viscous liquid or solid at room temperature, depending on its specific formulation and purity. The compound is known for its potential applications as a surfactant, lubricant, or in various chemical syntheses due to its ability to interact with both polar and non-polar substances. Its molecular structure allows for significant hydrophobic interactions, making it useful in formulations requiring emulsification or stabilization. Additionally, it may exhibit thermal stability and resistance to degradation, which are advantageous in industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are in place during its use.
Formula:C22H44N2O2
InChI:InChI=1S/C22H44N2O2/c1-5-9-15-19(7-3)21(25)23-17-13-11-12-14-18-24-22(26)20(8-4)16-10-6-2/h19-20H,5-18H2,1-4H3,(H,23,25)(H,24,26)
InChI key:InChIKey=XZVMGPSLFYINSC-UHFFFAOYSA-N
SMILES:C(C(NCCCCCCNC(C(CCCC)CC)=O)=O)(CCCC)CC
Synonyms:- Hexanamide, N,N′-1,6-hexanediylbis[2-ethyl-
- Hexanamide, N,N′-hexamethylenebis[2-ethyl-
- N,N′-1,6-Hexanediylbis[2-ethylhexanamide]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
