CymitQuimica logo

CAS 13222-32-7

:

N-Methyl-N-(1-oxooctadecyl)-β-alanine

Description:
N-Methyl-N-(1-oxooctadecyl)-β-alanine, identified by its CAS number 13222-32-7, is an organic compound that features a long-chain fatty acid derivative. This substance is characterized by the presence of a β-alanine backbone, which is an amino acid known for its role in various biological processes. The "N-methyl" group indicates that a methyl group is attached to the nitrogen atom of the amine, which can influence the compound's solubility and biological activity. The "1-oxooctadecyl" portion refers to a long-chain fatty acid (specifically, an 18-carbon chain) with a carbonyl group, suggesting that it may exhibit surfactant properties. Such compounds often have applications in pharmaceuticals, cosmetics, and as emulsifying agents due to their amphiphilic nature, allowing them to interact with both hydrophilic and hydrophobic substances. Overall, the unique structure of N-Methyl-N-(1-oxooctadecyl)-β-alanine contributes to its potential utility in various industrial and biochemical applications.
Formula:C22H43NO3
InChI:InChI=1S/C22H43NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(24)23(2)20-19-22(25)26/h3-20H2,1-2H3,(H,25,26)
InChI key:InChIKey=GMHCJCQMNYOULB-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCC)(N(CCC(O)=O)C)=O
Synonyms:
  • β-Alanine, N-methyl-N-(1-oxooctadecyl)-
  • β-Alanine, N-methyl-N-stearoyl-
  • N-Methyl-N-(1-oxooctadecyl)-β-alanine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.