CAS 13222-45-2
:2,3-Pentadiene, 1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)-
Description:
2,3-Pentadiene, 1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)-, commonly referred to by its CAS number 13222-45-2, is a fluorinated organic compound characterized by its unique structure that includes multiple trifluoromethyl groups and a diene functionality. This compound is notable for its high degree of fluorination, which imparts significant chemical stability and alters its physical properties, such as boiling point and solubility. The presence of the diene structure suggests that it can participate in various chemical reactions, including polymerization and addition reactions, making it of interest in synthetic organic chemistry. Additionally, the fluorinated groups enhance its hydrophobicity and may contribute to its utility in specialized applications, such as in the development of advanced materials or as a potential intermediate in the synthesis of other fluorinated compounds. Overall, the unique combination of its diene and highly fluorinated characteristics makes it a compound of interest in both academic research and industrial applications.
Formula:C7F12
InChI:InChI=1/C7F12/c8-4(9,10)2(5(11,12)13)1-3(6(14,15)16)7(17,18)19
SMILES:C(=C(C(F)(F)F)C(F)(F)F)=C(C(F)(F)F)C(F)(F)F
Synonyms:- 1,1,1,5,5,5-Hexafluoro-2,4-Bis(Trifluoromethyl)Penta-2,3-Diene
- 2,3-Pentadiene, 1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.