CAS 132224-93-2
:2-(4-CYANO-PHENYL)ETHYLAMINE
Description:
2-(4-Cyano-phenyl)ethylamine, with the CAS number 132224-93-2, is an organic compound characterized by the presence of an ethylamine group attached to a phenyl ring that has a cyano substituent at the para position. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The cyano group (-CN) contributes to the compound's polarity and can enhance its reactivity, making it useful in various synthetic applications. Additionally, the presence of the phenyl group can impart aromatic characteristics, affecting the compound's stability and interaction with other chemical species. 2-(4-Cyano-phenyl)ethylamine may be utilized in pharmaceutical research and organic synthesis, particularly in the development of biologically active molecules. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, this compound's unique structural features make it a subject of interest in both academic and industrial chemistry.
Formula:C9H10N2
InChI:InChI=1/C9H10N2/c10-6-5-8-1-3-9(7-11)4-2-8/h1-4H,5-6,10H2
SMILES:c1cc(ccc1CCN)C#N
Synonyms:- 4-(2-Aminoethyl)benzonitrile
- Benzonitrile, 4-(2-Aminoethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
