CAS 13223-53-5
:[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
Description:
[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is a heterocyclic compound characterized by its fused triazole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its structure includes an amino group, which can participate in hydrogen bonding, enhancing its reactivity and potential interactions with biological targets. The presence of nitrogen atoms in both the triazole and pyrimidine rings imparts basicity, allowing it to act as a weak base. This compound is of interest in medicinal chemistry due to its potential pharmacological activities, including anti-inflammatory and antimicrobial properties. Additionally, its structural features may facilitate interactions with various biological receptors or enzymes, making it a candidate for further research in drug development. Overall, [1,2,4]triazolo[1,5-a]pyrimidin-2-amine represents a versatile scaffold in the realm of organic and medicinal chemistry.
Formula:C5H5N5
InChI:InChI=1/C5H5N5/c6-4-8-5-7-2-1-3-10(5)9-4/h1-3H,(H2,6,9)
SMILES:c1cnc2nc(=N)[nH]n2c1
Synonyms:- [1,2,4]Triazolo[1,5-a]pyrimidin-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[1,2,4]Triazolo[1,5-a]pyrimidin-2-amine
CAS:Formula:C5H5N5Purity:97%Color and Shape:SolidMolecular weight:135.1267[1,2,4]Triazolo[1,5-a]pyrimidin-2-amine
CAS:[1,2,4]Triazolo[1,5-a]pyrimidin-2-aminePurity:97%Molecular weight:135.13g/mol[1,2,4]Triazolo[1,5-a]pyrimidin-2-ylamine
CAS:Formula:C5H5N5Purity:95.0%Color and Shape:SolidMolecular weight:135.13[1,2,4]Triazolo[1,5-a]pyrimidin-2-ylamine
CAS:[1,2,4]Triazolo[1,5-a]pyrimidin-2-ylamine is a heterocyclic compound that is used to treat hematological and inflammatory diseases. It has been shown to have a long-term effect in treating autoimmune diseases and neurodegenerative diseases. It is also an aromatic hydrocarbon that can be used as a drug for the treatment of gastroenterological conditions such as ulcers or Crohn's disease.Formula:C5H5N5Purity:Min. 95%Molecular weight:135.13 g/mol



