CAS 132235-73-5

2',3'-dideoxy-3'-(hydroxymethyl)cytidine

Description:

2',3'-Dideoxy-3'-(hydroxymethyl)cytidine, commonly referred to as a nucleoside analog, is characterized by its structural modifications that enhance its antiviral properties. This compound features a hydroxymethyl group at the 3' position of the ribose sugar, which is crucial for its biological activity. The absence of the 2' hydroxyl group, typical of dideoxynucleosides, contributes to its ability to inhibit viral replication, making it a potential therapeutic agent against certain viral infections, particularly HIV. The presence of the cytidine base allows it to mimic natural nucleosides, facilitating its incorporation into viral DNA during replication. This incorporation ultimately leads to chain termination, preventing further viral propagation. Additionally, the compound's solubility and stability in biological systems are important for its efficacy as a drug. Overall, 2',3'-dideoxy-3'-(hydroxymethyl)cytidine represents a significant class of antiviral agents, with ongoing research aimed at optimizing its pharmacological properties and therapeutic applications.

Formula: C₁₀H₁₅N₃O₄

InChI: InChI=1/C10H15N3O4/c11-8-1-2-13(10(16)12-8)9-3-6(4-14)7(5-15)17-9/h1-2,6-7,9,14-15H,3-5H2,(H2,11,12,16)/t6-,7-,9-/m1/s1

SMILES: c1cn([C@H]2C[C@H](CO)[C@@H](CO)O2)c(nc1=N)O

2',3'-Dideoxy-3'-(hydroxymethyl)cytidine

Controlled Product

CAS: 132235-73-5

Formula: C₁₀H₁₅N₃O₄

Color and Shape: Neat

Molecular weight: 241.244

Ref: TR-D512450