CymitQuimica logo

CAS 132242-66-1

:

1,1′-[(Methylsilylene)di-3,1-propanediyl]bis[1,1-diphenylphosphine]

Description:
1,1′-[(Methylsilylene)di-3,1-propanediyl]bis[1,1-diphenylphosphine], with the CAS number 132242-66-1, is a chemical compound characterized by its unique structure that includes a methylsilylene group and two diphenylphosphine moieties. This compound is notable for its potential applications in organometallic chemistry and catalysis due to the presence of phosphorus, which can participate in various coordination and bonding interactions. The silylene component contributes to its reactivity and stability, making it an interesting subject for research in synthetic chemistry. Additionally, the presence of the diphenylphosphine groups enhances its ability to form complexes with transition metals, which can be useful in catalyzing chemical reactions. The compound's physical properties, such as solubility and melting point, would depend on its molecular interactions and the presence of functional groups. Overall, this compound exemplifies the intersection of silicon and phosphorus chemistry, offering insights into the design of new materials and catalysts.
Formula:C31H36P2Si
InChI:InChI=1S/C31H36P2Si/c1-34(26-14-24-32(28-16-6-2-7-17-28)29-18-8-3-9-19-29)27-15-25-33(30-20-10-4-11-21-30)31-22-12-5-13-23-31/h2-13,16-23,34H,14-15,24-27H2,1H3
InChI key:InChIKey=XTLQGICFBCFEJJ-UHFFFAOYSA-N
SMILES:P(CCC[SiH](CCCP(C1=CC=CC=C1)C2=CC=CC=C2)C)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:
  • Methylbis(3-diphenylphosphinopropyl)silane
  • Phosphine, 1,1′-[(methylsilylene)di-3,1-propanediyl]bis[1,1-diphenyl-
  • Bis[3-(diphenylphosphino)propyl](methyl)silane
  • Phosphine, [(methylsilylene)di-3,1-propanediyl]bis[diphenyl-
  • 1,1′-[(Methylsilylene)di-3,1-propanediyl]bis[1,1-diphenylphosphine]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.