
CAS 132252-86-9
:2-Propenethioamide, 2-cyano-3-(4-fluorophenyl)-, (Z)-
Description:
2-Propenethioamide, 2-cyano-3-(4-fluorophenyl)-, (Z)-, with the CAS number 132252-86-9, is an organic compound characterized by its unique functional groups and structural features. This compound contains a propenethioamide moiety, which indicates the presence of both a double bond and a thiocarbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of a cyano group (nitrile) adds to its polar character, enhancing solubility in polar solvents. Additionally, the 4-fluorophenyl substituent introduces electron-withdrawing properties, which can influence the compound's electronic structure and reactivity. The (Z)-configuration denotes that the highest priority substituents on the double bond are on the same side, affecting its stereochemistry and potentially its biological activity. Overall, this compound may exhibit interesting chemical behavior and could be of interest in fields such as medicinal chemistry or materials science, where its unique properties can be exploited for various applications.
Formula:C10H7FN2S
InChI:InChI=1S/C10H7FN2S/c11-9-3-1-7(2-4-9)5-8(6-12)10(13)14/h1-5H,(H2,13,14)/b8-5-
InChI key:InChIKey=TXTBVZMAVKCLRA-YVMONPNESA-N
SMILES:C(=C(\C(N)=S)/C#N)\C1=CC=C(F)C=C1
Synonyms:- 2-Propenethioamide, 2-cyano-3-(4-fluorophenyl)-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.