CymitQuimica logo

CAS 132277-33-9

:

2-(3-Methylbut-2-enyloxy)phenol

Description:
2-(3-Methylbut-2-enyloxy)phenol, identified by its CAS number 132277-33-9, is an organic compound characterized by the presence of a phenolic group and an ether linkage. This compound features a substituted phenol structure, where a 3-methylbut-2-enyloxy group is attached to the aromatic ring. The presence of the alkene in the side chain contributes to its reactivity, potentially allowing for various chemical transformations. The compound is likely to exhibit properties typical of phenolic compounds, such as moderate solubility in organic solvents and potential antioxidant activity. Its structure suggests that it may participate in hydrogen bonding due to the hydroxyl group, influencing its physical properties like boiling and melting points. Additionally, the presence of the alkene may impart unique characteristics, such as increased reactivity in polymerization or cross-linking reactions. Overall, 2-(3-Methylbut-2-enyloxy)phenol is of interest in various chemical applications, including materials science and organic synthesis.
Formula:C11H14O2
InChI:InChI=1/C11H14O2/c1-9(2)7-8-13-11-6-4-3-5-10(11)12/h3-7,12H,8H2,1-2H3
SMILES:CC(=CCOc1ccccc1O)C
Synonyms:
  • 2-[(3-Methyl-2-butenyl)oxy]phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.