CAS 132281-90-4
:ethyl 3-(4-methyl-1H-pyrrol-3-yl)propanoate
Description:
Ethyl 3-(4-methyl-1H-pyrrol-3-yl)propanoate, with the CAS number 132281-90-4, is an organic compound characterized by its ester functional group and a pyrrole ring. This compound features a propanoate backbone, where the ethyl group is attached to the carboxylate portion, contributing to its ester characteristics. The presence of the 4-methyl-1H-pyrrole moiety introduces heteroatoms and contributes to the compound's potential biological activity, as pyrrole derivatives are often associated with various pharmacological properties. Ethyl 3-(4-methyl-1H-pyrrol-3-yl)propanoate is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if ingested or inhaled.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-3-13-10(12)5-4-9-7-11-6-8(9)2/h6-7,11H,3-5H2,1-2H3
Synonyms:- Ethyl 3-(4-methyl-1H-pyrrol-3-yl)propanoate
- 1H-Pyrrole-3-propanoic acid, 4-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
