CAS 132287-17-3

5-[2-(3,4-dimethylphenyl)-2-phenylethyl]-1H-imidazole hydrochloride

Description:

5-[2-(3,4-Dimethylphenyl)-2-phenylethyl]-1H-imidazole hydrochloride is a chemical compound characterized by its imidazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a phenylethyl side chain that is further substituted with a 3,4-dimethylphenyl group, contributing to its structural complexity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the imidazole ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may impart specific pharmacological properties, including potential roles as an enzyme inhibitor or receptor modulator. The compound's characteristics, such as melting point, solubility, and stability, can vary based on its formulation and the conditions under which it is handled. Overall, this substance is significant in research contexts, particularly in the development of therapeutic agents.

Formula: C₁₉H₂₁ClN₂

InChI: InChI=1/C19H20N2.ClH/c1-14-8-9-17(10-15(14)2)19(11-18-12-20-13-21-18)16-6-4-3-5-7-16;/h3-10,12-13,19H,11H2,1-2H3,(H,20,21);1H

SMILES: Cc1ccc(cc1C)C(Cc1cnc[nH]1)c1ccccc1.Cl