CymitQuimica logo

CAS 132289-57-7

:

Acetamide, N,2-dimethoxy-N-methyl-

Description:
Acetamide, N,2-dimethoxy-N-methyl- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This substance features a methyl group and two methoxy groups attached to the nitrogen atom, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Acetamides generally exhibit moderate polarity due to the amide bond, which can engage in hydrogen bonding. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H11NO3
InChI:InChI=1S/C5H11NO3/c1-6(9-3)5(7)4-8-2/h4H2,1-3H3
InChI key:YFNOEDJHRRXTRH-UHFFFAOYSA-N
SMILES:CN(C(=O)COC)OC
Synonyms:
  • N-Methoxy-N-methyl-2-methoxyacetamide
Found 4 products.