CymitQuimica logo

CAS 132289-68-0

:

3-(2-Thienyl)-2,5-piperazinedione

Description:
3-(2-Thienyl)-2,5-piperazinedione, identified by its CAS number 132289-68-0, is a chemical compound characterized by its unique structure, which includes a piperazinedione core substituted with a thienyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thienyl moiety, which can influence its interaction with biological targets. The piperazinedione structure contributes to its stability and may facilitate various chemical reactions, including potential applications in medicinal chemistry. The compound is likely to be soluble in organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, compounds of this nature may exhibit interesting pharmacological properties, making them subjects of research in drug development. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination. Overall, 3-(2-Thienyl)-2,5-piperazinedione represents a class of compounds with potential utility in various chemical and pharmaceutical applications.
Formula:C8H8N2O2S
InChI:InChI=1S/C8H8N2O2S/c11-6-4-9-8(12)7(10-6)5-2-1-3-13-5/h1-3,7H,4H2,(H,9,12)(H,10,11)
InChI key:InChIKey=JRMRWILUSIZZPU-UHFFFAOYSA-N
SMILES:O=C1C(NC(=O)CN1)C2=CC=CS2
Synonyms:
  • 2,5-Piperazinedione, 3-(2-thienyl)-
  • 3-Thiophen-2-ylpiperazine-2,5-dione
  • 3-(2-Thienyl)-2,5-piperazinedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.